ChemNet > CAS > 321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride
321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride
| termék neve |
2,1,3-benzothiadiazole-5-carbonyl chloride |
| MF |
C7H3ClN2OS |
| Molekulatömeg |
198.6295 |
| InChI |
InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H |
| CAS-szám |
321309-31-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.577g/cm3 |
| Olvadáspont |
113℃ |
| Forráspont |
297.6°C at 760 mmHg |
| Törésmutató |
1.704 |
| Gyulladáspont |
133.8°C |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
